C17H16FN3O3 — CID 169415366
3-(3-cyano-2-pyridinyl)-5-fluoro-N-[2-(2-hydroxyethoxy)ethyl]benzamide (PubChem CID 169415366) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is 3-(3-cyano-2-pyridinyl)-5-fluoro-N-[2-(2-hydroxyethoxy)ethyl]benzamide.
| Compound Name | 3-(3-cyano-2-pyridinyl)-5-fluoro-N-[2-(2-hydroxyethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 169415366 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-(3-cyano-2-pyridinyl)-5-fluoro-N-[2-(2-hydroxyethoxy)ethyl]benzamide |
| SMILES | N#Cc1cccnc1-c1cc(F)cc(C(=O)NCCOCCO)c1 |
| InChI | InChI=1S/C17H16FN3O3/c18-15-9-13(16-12(11-19)2-1-3-20-16)8-14(10-15)17(23)21-4-6-24-7-5-22/h1-3,8-10,22H,4-7H2,(H,21,23) |
| InChIKey | NXDSZBCLPLYIOM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|