C24H27NO5 — CID 169416361
4-methyl-8-(oxolan-2-ylmethoxy)-2-(2,3,4-trimethoxyphenyl)quinoline (PubChem CID 169416361) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 4-methyl-8-(oxolan-2-ylmethoxy)-2-(2,3,4-trimethoxyphenyl)quinoline.
| Compound Name | 4-methyl-8-(oxolan-2-ylmethoxy)-2-(2,3,4-trimethoxyphenyl)quinoline |
|---|---|
| PubChem CID | 169416361 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 4-methyl-8-(oxolan-2-ylmethoxy)-2-(2,3,4-trimethoxyphenyl)quinoline |
| SMILES | COc1ccc(-c2cc(C)c3cccc(OCC4CCCO4)c3n2)c(OC)c1OC |
| InChI | InChI=1S/C24H27NO5/c1-15-13-19(18-10-11-21(26-2)24(28-4)23(18)27-3)25-22-17(15)8-5-9-20(22)30-14-16-7-6-12-29-16/h5,8-11,13,16H,6-7,12,14H2,1-4H3 |
| InChIKey | SUUKMLQLQMVUFZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |