C23H29N3O3 — CID 169421424
N-[4-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]cyclohexyl]quinoline-6-carboxamide (PubChem CID 169421424) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[4-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]cyclohexyl]quinoline-6-carboxamide.
| Compound Name | N-[4-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]cyclohexyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 169421424 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[4-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]cyclohexyl]quinoline-6-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)C2CCC(NC(=O)c3ccc4ncccc4c3)CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C23H29N3O3/c1-15-13-26(14-16(2)29-15)23(28)17-5-8-20(9-6-17)25-22(27)19-7-10-21-18(12-19)4-3-11-24-21/h3-4,7,10-12,15-17,20H,5-6,8-9,13-14H2,1-2H3,(H,25,27)/t15-,16+,17?,20? |
| InChIKey | XDZAKVHEWSWCGS-HLVUACMISA-N |
| XLogP | 3.16 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |