C20H28ClN3O4S — CID 169423206
(2S)-4-(2-chloroacetyl)-N-cyclohexyl-1-(4-methylphenyl)sulfonylpiperazine-2-carboxamide (PubChem CID 169423206) has the molecular formula C20H28ClN3O4S and a molecular weight of 441.98 g/mol. Its IUPAC name is (2S)-4-(2-chloroacetyl)-N-cyclohexyl-1-(4-methylphenyl)sulfonylpiperazine-2-carboxamide.
| Compound Name | (2S)-4-(2-chloroacetyl)-N-cyclohexyl-1-(4-methylphenyl)sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 169423206 |
| Molecular Formula | C20H28ClN3O4S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (2S)-4-(2-chloroacetyl)-N-cyclohexyl-1-(4-methylphenyl)sulfonylpiperazine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)CCl)C[C@H]2C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H28ClN3O4S/c1-15-7-9-17(10-8-15)29(27,28)24-12-11-23(19(25)13-21)14-18(24)20(26)22-16-5-3-2-4-6-16/h7-10,16,18H,2-6,11-14H2,1H3,(H,22,26)/t18-/m0/s1 |
| InChIKey | ULTLAPONRHTGOB-SFHVURJKSA-N |
| XLogP | 1.88 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|