C14H13N3O4 — CID 16942441
4-nitro-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)benzamide (PubChem CID 16942441) has the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. Its IUPAC name is 4-nitro-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)benzamide.
| Compound Name | 4-nitro-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 16942441 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-nitro-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)benzamide |
| SMILES | O=C(Nc1onc2c1CCCC2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H13N3O4/c18-13(9-5-7-10(8-6-9)17(19)20)15-14-11-3-1-2-4-12(11)16-21-14/h5-8H,1-4H2,(H,15,18) |
| InChIKey | KCZVEKINJLZKDH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|