C27H37Cl2N7O — CID 169427888
2,6-bis[4-(4,4-dimethylpiperazin-4-ium-1-yl)-2-pyridinyl]-1H-pyridin-4-one dichloride (PubChem CID 169427888) has the molecular formula C27H37Cl2N7O and a molecular weight of 546.55 g/mol. Its IUPAC name is 2,6-bis[4-(4,4-dimethylpiperazin-4-ium-1-yl)-2-pyridinyl]-1H-pyridin-4-one dichloride.
| Compound Name | 2,6-bis[4-(4,4-dimethylpiperazin-4-ium-1-yl)-2-pyridinyl]-1H-pyridin-4-one dichloride |
|---|---|
| PubChem CID | 169427888 |
| Molecular Formula | C27H37Cl2N7O |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 2,6-bis[4-(4,4-dimethylpiperazin-4-ium-1-yl)-2-pyridinyl]-1H-pyridin-4-one dichloride |
| SMILES | C[N+]1(C)CCN(c2ccnc(-c3cc(=O)cc(-c4cc(N5CC[N+](C)(C)CC5)ccn4)[nH]3)c2)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C27H36N7O.2ClH/c1-33(2)13-9-31(10-14-33)21-5-7-28-24(17-21)26-19-23(35)20-27(30-26)25-18-22(6-8-29-25)32-11-15-34(3,4)16-12-32;;/h5-8,17-20H,9-16H2,1-4H3;2*1H/q+1;;/p-1 |
| InChIKey | NMJZZCOFKMGKHY-UHFFFAOYSA-M |
| XLogP | -3.70 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|