C28H41N7O+2 — CID 89220163
2-[(3E,5Z)-6-amino-4-(4,4-dimethylpiperazin-4-ium-1-yl)hexa-1,3,5-trien-2-yl]-6-[4-(4,4-dimethylpiperazin-4-ium-1-yl)-2-pyridinyl]-1H-pyridin-4-one (PubChem CID 89220163) has the molecular formula C28H41N7O+2 and a molecular weight of 491.68 g/mol. Its IUPAC name is 2-[(3E,5Z)-6-amino-4-(4,4-dimethylpiperazin-4-ium-1-yl)hexa-1,3,5-trien-2-yl]-6-[4-(4,4-dimethylpiperazin-4-ium-1-yl)-2-pyridinyl]-1H-pyridin-4-one.
| Compound Name | 2-[(3E,5Z)-6-amino-4-(4,4-dimethylpiperazin-4-ium-1-yl)hexa-1,3,5-trien-2-yl]-6-[4-(4,4-dimethylpiperazin-4-ium-1-yl)-2-pyridinyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 89220163 |
| Molecular Formula | C28H41N7O+2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | 2-[(3E,5Z)-6-amino-4-(4,4-dimethylpiperazin-4-ium-1-yl)hexa-1,3,5-trien-2-yl]-6-[4-(4,4-dimethylpiperazin-4-ium-1-yl)-2-pyridinyl]-1H-pyridin-4-one |
| SMILES | C=C(/C=C(\C=C/N)N1CC[N+](C)(C)CC1)c1cc(=O)cc(-c2cc(N3CC[N+](C)(C)CC3)ccn2)[nH]1 |
| InChI | InChI=1S/C28H40N7O/c1-22(18-23(6-8-29)32-10-14-34(2,3)15-11-32)26-20-25(36)21-28(31-26)27-19-24(7-9-30-27)33-12-16-35(4,5)17-13-33/h6-9,18-21H,1,10-17,29H2,2-5H3/q+1/p+1/b8-6-,23-18+ |
| InChIKey | HTUPDOFZELIESS-GWEJNXOXSA-O |
| XLogP | 2.09 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|