C50H52N2O16S4 — CID 169431663
bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl] 2-methylidenebutanedioate;[3-(3-sulfanylpropanoyloxy)-2,2-bis(3-sulfanylpropanoyloxymethyl)propyl] 3-sulfanylpropanoate (PubChem CID 169431663) has the molecular formula C50H52N2O16S4 and a molecular weight of 1065.23 g/mol. Its IUPAC name is bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl] 2-methylidenebutanedioate;[3-(3-sulfanylpropanoyloxy)-2,2-bis(3-sulfanylpropanoyloxymethyl)propyl] 3-sulfanylpropanoate.
| Compound Name | bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl] 2-methylidenebutanedioate;[3-(3-sulfanylpropanoyloxy)-2,2-bis(3-sulfanylpropanoyloxymethyl)propyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 169431663 |
| Molecular Formula | C50H52N2O16S4 |
| Molecular Weight | 1065.23 g/mol |
| Exact Mass | 1064.22 |
| IUPAC Name | bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl] 2-methylidenebutanedioate;[3-(3-sulfanylpropanoyloxy)-2,2-bis(3-sulfanylpropanoyloxymethyl)propyl] 3-sulfanylpropanoate |
| SMILES | C=C(CC(=O)OCCN1C(=O)c2cccc3cccc(c23)C1=O)C(=O)OCCN1C(=O)c2cccc3cccc(c23)C1=O.O=C(CCS)OCC(COC(=O)CCS)(COC(=O)CCS)COC(=O)CCS |
| InChI | InChI=1S/C33H24N2O8.C17H28O8S4/c1-19(33(41)43-17-15-35-31(39)24-12-4-8-21-9-5-13-25(28(21)24)32(35)40)18-26(36)42-16-14-34-29(37)22-10-2-6-20-7-3-11-23(27(20)22)30(34)38;18-13(1-5-26)22-9-17(10-23-14(19)2-6-27,11-24-15(20)3-7-28)12-25-16(21)4-8-29/h2-13H,1,14-18H2;26-29H,1-12H2 |
| InChIKey | YLUAUXUBUGGROJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 232.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.23 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|