C7H11NO — CID 169432733
1-(4,4,5,5,6,6-hexadeuterio-3H-pyridin-2-yl)ethanone (PubChem CID 169432733) has the molecular formula C7H11NO and a molecular weight of 131.21 g/mol. Its IUPAC name is 1-(4,4,5,5,6,6-hexadeuterio-3H-pyridin-2-yl)ethanone.
| Compound Name | 1-(4,4,5,5,6,6-hexadeuterio-3H-pyridin-2-yl)ethanone |
|---|---|
| PubChem CID | 169432733 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 131.21 g/mol |
| Exact Mass | 131.12 |
| IUPAC Name | 1-(4,4,5,5,6,6-hexadeuterio-3H-pyridin-2-yl)ethanone |
| SMILES | [2H]C1([2H])CC(C(C)=O)=NC([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C7H11NO/c1-6(9)7-4-2-3-5-8-7/h2-5H2,1H3/i2D2,3D2,5D2 |
| InChIKey | GNZWXNKZMHJXNU-KFBGVRCKSA-N |
| XLogP | 1.20 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |