C22H27ClN2O — CID 169432770
N-[1-[2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]piperidin-4-yl]-N-phenylprop-2-enamide;hydrochloride (PubChem CID 169432770) has the molecular formula C22H27ClN2O and a molecular weight of 375.95 g/mol. Its IUPAC name is N-[1-[2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]piperidin-4-yl]-N-phenylprop-2-enamide;hydrochloride.
| Compound Name | N-[1-[2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]piperidin-4-yl]-N-phenylprop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 169432770 |
| Molecular Formula | C22H27ClN2O |
| Molecular Weight | 375.95 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N-[1-[2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]piperidin-4-yl]-N-phenylprop-2-enamide;hydrochloride |
| SMILES | Cl.[2H]c1c([2H])c([2H])c(CCN2CCC(N(C(=O)C=C)c3ccccc3)CC2)c([2H])c1[2H] |
| InChI | InChI=1S/C22H26N2O.ClH/c1-2-22(25)24(20-11-7-4-8-12-20)21-14-17-23(18-15-21)16-13-19-9-5-3-6-10-19;/h2-12,21H,1,13-18H2;1H/i3D,5D,6D,9D,10D; |
| InChIKey | YUHNRLIKLNYPDD-BSBWQDPUSA-N |
| XLogP | 4.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.95 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|