C13H18Cl3NO — CID 169435148
1-(3,4-dichlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-1-one;hydrochloride (PubChem CID 169435148) has the molecular formula C13H18Cl3NO and a molecular weight of 319.71 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-1-one;hydrochloride.
| Compound Name | 1-(3,4-dichlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 169435148 |
| Molecular Formula | C13H18Cl3NO |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-1-one;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])C(NC(C)C(=O)c1ccc(Cl)c(Cl)c1)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C13H17Cl2NO.ClH/c1-8(16-13(2,3)4)12(17)9-5-6-10(14)11(15)7-9;/h5-8,16H,1-4H3;1H/i2D3,3D3,4D3; |
| InChIKey | YFAPNLTUNVYSBO-WWMMTMLWSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |