C16H11ClN2O2 — CID 169436296
3-[(7-chloroquinolin-4-yl)amino]-2,4,5-trideuterio-6-hydroxy(13C)benzaldehyde (PubChem CID 169436296) has the molecular formula C16H11ClN2O2 and a molecular weight of 302.74 g/mol. Its IUPAC name is 3-[(7-chloroquinolin-4-yl)amino]-2,4,5-trideuterio-6-hydroxy(13C)benzaldehyde.
| Compound Name | 3-[(7-chloroquinolin-4-yl)amino]-2,4,5-trideuterio-6-hydroxy(13C)benzaldehyde |
|---|---|
| PubChem CID | 169436296 |
| Molecular Formula | C16H11ClN2O2 |
| Molecular Weight | 302.74 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-[(7-chloroquinolin-4-yl)amino]-2,4,5-trideuterio-6-hydroxy(13C)benzaldehyde |
| SMILES | [2H]c1c([2H])c(Nc2ccnc3cc(Cl)ccc23)c([2H])c([13CH]=O)c1O |
| InChI | InChI=1S/C16H11ClN2O2/c17-11-1-3-13-14(5-6-18-15(13)8-11)19-12-2-4-16(21)10(7-12)9-20/h1-9,21H,(H,18,19)/i2D,4D,7D,9+1 |
| InChIKey | AZKNHPGTHFOACE-IEJUKMQQSA-N |
| XLogP | 4.15 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.74 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|