C23H27ClN6O2S — CID 169437097
N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]methyl]-1,3-thiazole-5-carboxamide (PubChem CID 169437097) has the molecular formula C23H27ClN6O2S and a molecular weight of 495.08 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]methyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]methyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 169437097 |
| Molecular Formula | C23H27ClN6O2S |
| Molecular Weight | 495.08 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]methyl]-1,3-thiazole-5-carboxamide |
| SMILES | [2H]C1([2H])N(CCO)C([2H])([2H])C([2H])([2H])N(c2cc(Cc3ncc(C(=O)Nc4c(C)cccc4Cl)s3)nc(C)n2)C1([2H])[2H] |
| InChI | InChI=1S/C23H27ClN6O2S/c1-15-4-3-5-18(24)22(15)28-23(32)19-14-25-21(33-19)13-17-12-20(27-16(2)26-17)30-8-6-29(7-9-30)10-11-31/h3-5,12,14,31H,6-11,13H2,1-2H3,(H,28,32)/i6D2,7D2,8D2,9D2 |
| InChIKey | JXEIFWYMJZWNJC-COMRDEPKSA-N |
| XLogP | 3.16 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.08 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |