C14H15N3O — CID 169441439
4-[(4-cyclopropyl-6-methylpyrimidin-2-yl)amino]-2,3,5,6-tetradeuteriophenol (PubChem CID 169441439) has the molecular formula C14H15N3O and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-[(4-cyclopropyl-6-methylpyrimidin-2-yl)amino]-2,3,5,6-tetradeuteriophenol.
| Compound Name | 4-[(4-cyclopropyl-6-methylpyrimidin-2-yl)amino]-2,3,5,6-tetradeuteriophenol |
|---|---|
| PubChem CID | 169441439 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 4-[(4-cyclopropyl-6-methylpyrimidin-2-yl)amino]-2,3,5,6-tetradeuteriophenol |
| SMILES | [2H]c1c([2H])c(Nc2nc(C)cc(C3CC3)n2)c([2H])c([2H])c1O |
| InChI | InChI=1S/C14H15N3O/c1-9-8-13(10-2-3-10)17-14(15-9)16-11-4-6-12(18)7-5-11/h4-8,10,18H,2-3H2,1H3,(H,15,16,17)/i4D,5D,6D,7D |
| InChIKey | LBDZGKRFRHHISM-UGWFXTGHSA-N |
| XLogP | 3.11 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|