C13H19NO2 — CID 169442366
3,3,3-trideuterio-N-hydroxy-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 169442366) has the molecular formula C13H19NO2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 3,3,3-trideuterio-N-hydroxy-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | 3,3,3-trideuterio-N-hydroxy-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 169442366 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3,3,3-trideuterio-N-hydroxy-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | [2H]C([2H])([2H])C(C(=O)NO)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C13H19NO2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(15)14-16/h4-7,9-10,16H,8H2,1-3H3,(H,14,15)/i3D3 |
| InChIKey | BYPIURIATSUHDW-HPRDVNIFSA-N |
| XLogP | 2.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|