C14H16O6 — CID 169444236
2-(5-carboxypentoxycarbonyl)-3,4,5,6-tetradeuteriobenzoic acid (PubChem CID 169444236) has the molecular formula C14H16O6 and a molecular weight of 284.30 g/mol. Its IUPAC name is 2-(5-carboxypentoxycarbonyl)-3,4,5,6-tetradeuteriobenzoic acid.
| Compound Name | 2-(5-carboxypentoxycarbonyl)-3,4,5,6-tetradeuteriobenzoic acid |
|---|---|
| PubChem CID | 169444236 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-(5-carboxypentoxycarbonyl)-3,4,5,6-tetradeuteriobenzoic acid |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)OCCCCCC(=O)O)c(C(=O)O)c1[2H] |
| InChI | InChI=1S/C14H16O6/c15-12(16)8-2-1-5-9-20-14(19)11-7-4-3-6-10(11)13(17)18/h3-4,6-7H,1-2,5,8-9H2,(H,15,16)(H,17,18)/i3D,4D,6D,7D |
| InChIKey | QRHRDZGROXTDDX-ZDPIWEEJSA-N |
| XLogP | 2.19 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|