C22H34O6 — CID 171380112
bis(6-hydroxy-5-methylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (PubChem CID 171380112) has the molecular formula C22H34O6 and a molecular weight of 398.53 g/mol. Its IUPAC name is bis(6-hydroxy-5-methylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate.
| Compound Name | bis(6-hydroxy-5-methylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 171380112 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | bis(6-hydroxy-5-methylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)OCCCCC(C)CO)c(C(=O)OCCCCC(C)CO)c1[2H] |
| InChI | InChI=1S/C22H34O6/c1-17(15-23)9-5-7-13-27-21(25)19-11-3-4-12-20(19)22(26)28-14-8-6-10-18(2)16-24/h3-4,11-12,17-18,23-24H,5-10,13-16H2,1-2H3/i3D,4D,11D,12D |
| InChIKey | ILUNEEJJEAXPJI-MIOPFRHHSA-N |
| XLogP | 3.60 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|