C24H24ClN3O5 — CID 169445133
3-oxa-14,21-diazahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(25),2(15),4,7,9,11,13,16-octaen-6-ylidene(1,1,2,2,2-pentadeuterioethyl)azanium perchlorate (PubChem CID 169445133) has the molecular formula C24H24ClN3O5 and a molecular weight of 474.96 g/mol. Its IUPAC name is 3-oxa-14,21-diazahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(25),2(15),4,7,9,11,13,16-octaen-6-ylidene(1,1,2,2,2-pentadeuterioethyl)azanium perchlorate.
| Compound Name | 3-oxa-14,21-diazahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(25),2(15),4,7,9,11,13,16-octaen-6-ylidene(1,1,2,2,2-pentadeuterioethyl)azanium perchlorate |
|---|---|
| PubChem CID | 169445133 |
| Molecular Formula | C24H24ClN3O5 |
| Molecular Weight | 474.96 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 3-oxa-14,21-diazahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(25),2(15),4,7,9,11,13,16-octaen-6-ylidene(1,1,2,2,2-pentadeuterioethyl)azanium perchlorate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])/[NH+]=c1\cc2oc3c4c5c(cc3nc-2c2ccccc12)CCCN5CCC4.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H23N3O.ClHO4/c1-2-25-19-14-21-22(17-9-4-3-8-16(17)19)26-20-13-15-7-5-11-27-12-6-10-18(23(15)27)24(20)28-21;2-1(3,4)5/h3-4,8-9,13-14H,2,5-7,10-12H2,1H3;(H,2,3,4,5)/b25-19+;/i1D3,2D2; |
| InChIKey | HDJUFIJUNWBWGE-HWFIEJDBSA-N |
| XLogP | -1.97 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.96 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|