C21H36NO+ — CID 169447341
(3-cyclohexyl-3-hydroxy-3-phenylpropyl)-diethyl-(1,1,2,2,2-pentadeuterioethyl)azanium (PubChem CID 169447341) has the molecular formula C21H36NO+ and a molecular weight of 323.56 g/mol. Its IUPAC name is (3-cyclohexyl-3-hydroxy-3-phenylpropyl)-diethyl-(1,1,2,2,2-pentadeuterioethyl)azanium.
| Compound Name | (3-cyclohexyl-3-hydroxy-3-phenylpropyl)-diethyl-(1,1,2,2,2-pentadeuterioethyl)azanium |
|---|---|
| PubChem CID | 169447341 |
| Molecular Formula | C21H36NO+ |
| Molecular Weight | 323.56 g/mol |
| Exact Mass | 323.31 |
| IUPAC Name | (3-cyclohexyl-3-hydroxy-3-phenylpropyl)-diethyl-(1,1,2,2,2-pentadeuterioethyl)azanium |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[N+](CC)(CC)CCC(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H36NO/c1-4-22(5-2,6-3)18-17-21(23,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7,9-10,13-14,20,23H,4-6,8,11-12,15-18H2,1-3H3/q+1/i1D3,4D2 |
| InChIKey | NPRHVSBSZMAEIN-SGEUAGPISA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|