C10H19NO2S — CID 169447952
N-but-2-enyl-N-methyl-1,1-dioxothian-4-amine (PubChem CID 169447952) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is N-but-2-enyl-N-methyl-1,1-dioxothian-4-amine.
| Compound Name | N-but-2-enyl-N-methyl-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 169447952 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-but-2-enyl-N-methyl-1,1-dioxothian-4-amine |
| SMILES | CC=CCN(C)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H19NO2S/c1-3-4-7-11(2)10-5-8-14(12,13)9-6-10/h3-4,10H,5-9H2,1-2H3 |
| InChIKey | JYPGNXAVCIJFQC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|