C16H23NO3 — CID 169451476
1-[1-(4-methoxyphenyl)-2-(methylamino)ethyl]cyclohex-4-ene-1,3-diol (PubChem CID 169451476) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)-2-(methylamino)ethyl]cyclohex-4-ene-1,3-diol.
| Compound Name | 1-[1-(4-methoxyphenyl)-2-(methylamino)ethyl]cyclohex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 169451476 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)-2-(methylamino)ethyl]cyclohex-4-ene-1,3-diol |
| SMILES | CNCC(c1ccc(OC)cc1)C1(O)CC=CC(O)C1 |
| InChI | InChI=1S/C16H23NO3/c1-17-11-15(12-5-7-14(20-2)8-6-12)16(19)9-3-4-13(18)10-16/h3-8,13,15,17-19H,9-11H2,1-2H3 |
| InChIKey | XYQXFZJVOPBRBP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|