C17H25NO3 — CID 169451815
2-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohex-3-ene-1,2-diol (PubChem CID 169451815) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohex-3-ene-1,2-diol.
| Compound Name | 2-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 169451815 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohex-3-ene-1,2-diol |
| SMILES | COc1ccc(C(CN(C)C)C2(O)C=CCCC2O)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-18(2)12-15(13-7-9-14(21-3)10-8-13)17(20)11-5-4-6-16(17)19/h5,7-11,15-16,19-20H,4,6,12H2,1-3H3 |
| InChIKey | ADQBLSIRWZATMW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|