C17H25NO2 — CID 70451025
1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]cyclohex-2-en-1-ol (PubChem CID 70451025) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]cyclohex-2-en-1-ol.
| Compound Name | 1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 70451025 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]cyclohex-2-en-1-ol |
| SMILES | COc1ccc(C(CC2(O)C=CCCC2)N(C)C)cc1 |
| InChI | InChI=1S/C17H25NO2/c1-18(2)16(13-17(19)11-5-4-6-12-17)14-7-9-15(20-3)10-8-14/h5,7-11,16,19H,4,6,12-13H2,1-3H3 |
| InChIKey | UYXYJYMAVFRJPV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|