C21H31NO8 — CID 169438296
(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[4-[1-(1-hydroxycyclohexyl)-2-(methylamino)ethyl]phenoxy]oxane-2-carboxylic acid (PubChem CID 169438296) has the molecular formula C21H31NO8 and a molecular weight of 425.48 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[4-[1-(1-hydroxycyclohexyl)-2-(methylamino)ethyl]phenoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[4-[1-(1-hydroxycyclohexyl)-2-(methylamino)ethyl]phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 169438296 |
| Molecular Formula | C21H31NO8 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[4-[1-(1-hydroxycyclohexyl)-2-(methylamino)ethyl]phenoxy]oxane-2-carboxylic acid |
| SMILES | CNCC(c1ccc(OC2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C21H31NO8/c1-22-11-14(21(28)9-3-2-4-10-21)12-5-7-13(8-6-12)29-20-17(25)15(23)16(24)18(30-20)19(26)27/h5-8,14-18,20,22-25,28H,2-4,9-11H2,1H3,(H,26,27)/t14?,15-,16-,17+,18-,20?/m0/s1 |
| InChIKey | UDNAJOOLWIWCAW-UDDOEOBRSA-N |
| XLogP | -0.04 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |