C15H12FN3OS — CID 169452188
5-fluoro-2-[[[3-(1,2-thiazol-3-yl)-2-pyridinyl]amino]methyl]phenol (PubChem CID 169452188) has the molecular formula C15H12FN3OS and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-fluoro-2-[[[3-(1,2-thiazol-3-yl)-2-pyridinyl]amino]methyl]phenol.
| Compound Name | 5-fluoro-2-[[[3-(1,2-thiazol-3-yl)-2-pyridinyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 169452188 |
| Molecular Formula | C15H12FN3OS |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-fluoro-2-[[[3-(1,2-thiazol-3-yl)-2-pyridinyl]amino]methyl]phenol |
| SMILES | Oc1cc(F)ccc1CNc1ncccc1-c1ccsn1 |
| InChI | InChI=1S/C15H12FN3OS/c16-11-4-3-10(14(20)8-11)9-18-15-12(2-1-6-17-15)13-5-7-21-19-13/h1-8,20H,9H2,(H,17,18) |
| InChIKey | VHMHZWAZTGHNTQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|