C13H11FN6O — CID 171807238
5-fluoro-2-[[[3-(2H-tetrazol-5-yl)-2-pyridinyl]amino]methyl]phenol (PubChem CID 171807238) has the molecular formula C13H11FN6O and a molecular weight of 286.27 g/mol. Its IUPAC name is 5-fluoro-2-[[[3-(2H-tetrazol-5-yl)-2-pyridinyl]amino]methyl]phenol.
| Compound Name | 5-fluoro-2-[[[3-(2H-tetrazol-5-yl)-2-pyridinyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 171807238 |
| Molecular Formula | C13H11FN6O |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-fluoro-2-[[[3-(2H-tetrazol-5-yl)-2-pyridinyl]amino]methyl]phenol |
| SMILES | Oc1cc(F)ccc1CNc1ncccc1-c1nn[nH]n1 |
| InChI | InChI=1S/C13H11FN6O/c14-9-4-3-8(11(21)6-9)7-16-12-10(2-1-5-15-12)13-17-19-20-18-13/h1-6,21H,7H2,(H,15,16)(H,17,18,19,20) |
| InChIKey | WLAMFJULOLBBRY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|