C14H12FN5O — CID 169452189
5-fluoro-2-[[[3-(1H-1,2,4-triazol-5-yl)-2-pyridinyl]amino]methyl]phenol (PubChem CID 169452189) has the molecular formula C14H12FN5O and a molecular weight of 285.28 g/mol. Its IUPAC name is 5-fluoro-2-[[[3-(1H-1,2,4-triazol-5-yl)-2-pyridinyl]amino]methyl]phenol.
| Compound Name | 5-fluoro-2-[[[3-(1H-1,2,4-triazol-5-yl)-2-pyridinyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 169452189 |
| Molecular Formula | C14H12FN5O |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 5-fluoro-2-[[[3-(1H-1,2,4-triazol-5-yl)-2-pyridinyl]amino]methyl]phenol |
| SMILES | Oc1cc(F)ccc1CNc1ncccc1-c1ncn[nH]1 |
| InChI | InChI=1S/C14H12FN5O/c15-10-4-3-9(12(21)6-10)7-17-13-11(2-1-5-16-13)14-18-8-19-20-14/h1-6,8,21H,7H2,(H,16,17)(H,18,19,20) |
| InChIKey | QRRUXNVQGIXBIR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|