C14H11FN4O2 — CID 169452190
5-fluoro-2-[[[3-(1,2,4-oxadiazol-3-yl)-2-pyridinyl]amino]methyl]phenol (PubChem CID 169452190) has the molecular formula C14H11FN4O2 and a molecular weight of 286.27 g/mol. Its IUPAC name is 5-fluoro-2-[[[3-(1,2,4-oxadiazol-3-yl)-2-pyridinyl]amino]methyl]phenol.
| Compound Name | 5-fluoro-2-[[[3-(1,2,4-oxadiazol-3-yl)-2-pyridinyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 169452190 |
| Molecular Formula | C14H11FN4O2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 5-fluoro-2-[[[3-(1,2,4-oxadiazol-3-yl)-2-pyridinyl]amino]methyl]phenol |
| SMILES | Oc1cc(F)ccc1CNc1ncccc1-c1ncon1 |
| InChI | InChI=1S/C14H11FN4O2/c15-10-4-3-9(12(20)6-10)7-17-13-11(2-1-5-16-13)14-18-8-21-19-14/h1-6,8,20H,7H2,(H,16,17) |
| InChIKey | PKBBIWJHJGYQOB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|