C18H23N5O4S — CID 169452347
ethyl 4-anilino-2-[2-(cyclopropylsulfonylamino)ethylamino]pyrimidine-5-carboxylate (PubChem CID 169452347) has the molecular formula C18H23N5O4S and a molecular weight of 405.48 g/mol. Its IUPAC name is ethyl 4-anilino-2-[2-(cyclopropylsulfonylamino)ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-anilino-2-[2-(cyclopropylsulfonylamino)ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 169452347 |
| Molecular Formula | C18H23N5O4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | ethyl 4-anilino-2-[2-(cyclopropylsulfonylamino)ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCNS(=O)(=O)C2CC2)nc1Nc1ccccc1 |
| InChI | InChI=1S/C18H23N5O4S/c1-2-27-17(24)15-12-20-18(19-10-11-21-28(25,26)14-8-9-14)23-16(15)22-13-6-4-3-5-7-13/h3-7,12,14,21H,2,8-11H2,1H3,(H2,19,20,22,23) |
| InChIKey | OQDGXIANBAKYJO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|