C8H9NO3S — CID 169478664
methyl 3-[5-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enoate (PubChem CID 169478664) has the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. Its IUPAC name is methyl 3-[5-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enoate.
| Compound Name | methyl 3-[5-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 169478664 |
| Molecular Formula | C8H9NO3S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | methyl 3-[5-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ncc(CO)s1 |
| InChI | InChI=1S/C8H9NO3S/c1-12-8(11)3-2-7-9-4-6(5-10)13-7/h2-4,10H,5H2,1H3 |
| InChIKey | QRNJBQYOEGLXKW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|