C16H18N2O3S — CID 170493516
benzyl N-[4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enyl]carbamate (PubChem CID 170493516) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is benzyl N-[4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493516 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | benzyl N-[4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1ncc(CO)s1)OCc1ccccc1 |
| InChI | InChI=1S/C16H18N2O3S/c19-11-14-10-18-15(22-14)8-4-5-9-17-16(20)21-12-13-6-2-1-3-7-13/h1-4,6-8,10,19H,5,9,11-12H2,(H,17,20) |
| InChIKey | KCQJPWCZZWFPLJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|