C9H5ClN4 — CID 169483640
3-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)prop-2-enenitrile (PubChem CID 169483640) has the molecular formula C9H5ClN4 and a molecular weight of 204.62 g/mol. Its IUPAC name is 3-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)prop-2-enenitrile.
| Compound Name | 3-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169483640 |
| Molecular Formula | C9H5ClN4 |
| Molecular Weight | 204.62 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 3-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)prop-2-enenitrile |
| SMILES | N#CC=Cc1c[nH]c2c(Cl)ncnc12 |
| InChI | InChI=1S/C9H5ClN4/c10-9-8-7(13-5-14-9)6(4-12-8)2-1-3-11/h1-2,4-5,12H |
| InChIKey | YVTULNQBILKQQU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.62 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|