C11H11ClN4 — CID 170464522
4-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-N-methylbut-3-yn-1-amine (PubChem CID 170464522) has the molecular formula C11H11ClN4 and a molecular weight of 234.69 g/mol. Its IUPAC name is 4-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-N-methylbut-3-yn-1-amine.
| Compound Name | 4-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-N-methylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 170464522 |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 4-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-N-methylbut-3-yn-1-amine |
| SMILES | CNCCC#Cc1c[nH]c2c(Cl)ncnc12 |
| InChI | InChI=1S/C11H11ClN4/c1-13-5-3-2-4-8-6-14-10-9(8)15-7-16-11(10)12/h6-7,13-14H,3,5H2,1H3 |
| InChIKey | AKYREINQALVREP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|