C18H22O7 — CID 169491868
methyl 6-[(1S)-1,4-dihydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 169491868) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is methyl 6-[(1S)-1,4-dihydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | methyl 6-[(1S)-1,4-dihydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 169491868 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | methyl 6-[(1S)-1,4-dihydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COC(=O)CCC(C)=CCc1c(O)c2c(c(C)c1OC)[C@@H](O)OC2=O |
| InChI | InChI=1S/C18H22O7/c1-9(6-8-12(19)23-3)5-7-11-15(20)14-13(10(2)16(11)24-4)17(21)25-18(14)22/h5,17,20-21H,6-8H2,1-4H3/t17-/m0/s1 |
| InChIKey | VIETWRMQYIXKOG-KRWDZBQOSA-N |
| XLogP | 2.31 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|