C24H21NO7 — CID 169492860
4-[3-carboxy-5-[2-(methylamino)-2-oxoethoxy]phenyl]-2-phenylmethoxybenzoic acid (PubChem CID 169492860) has the molecular formula C24H21NO7 and a molecular weight of 435.43 g/mol. Its IUPAC name is 4-[3-carboxy-5-[2-(methylamino)-2-oxoethoxy]phenyl]-2-phenylmethoxybenzoic acid.
| Compound Name | 4-[3-carboxy-5-[2-(methylamino)-2-oxoethoxy]phenyl]-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 169492860 |
| Molecular Formula | C24H21NO7 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 4-[3-carboxy-5-[2-(methylamino)-2-oxoethoxy]phenyl]-2-phenylmethoxybenzoic acid |
| SMILES | CNC(=O)COc1cc(C(=O)O)cc(-c2ccc(C(=O)O)c(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C24H21NO7/c1-25-22(26)14-31-19-10-17(9-18(11-19)23(27)28)16-7-8-20(24(29)30)21(12-16)32-13-15-5-3-2-4-6-15/h2-12H,13-14H2,1H3,(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | MQPAJUHCROZLSV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |