C18H23F3INO3 — CID 169493320
tert-butyl N-(cyclopropylmethyl)-N-[[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamate (PubChem CID 169493320) has the molecular formula C18H23F3INO3 and a molecular weight of 485.28 g/mol. Its IUPAC name is tert-butyl N-(cyclopropylmethyl)-N-[[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-(cyclopropylmethyl)-N-[[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 169493320 |
| Molecular Formula | C18H23F3INO3 |
| Molecular Weight | 485.28 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | tert-butyl N-(cyclopropylmethyl)-N-[[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(OCC(F)(F)F)c(I)c1)CC1CC1 |
| InChI | InChI=1S/C18H23F3INO3/c1-17(2,3)26-16(24)23(9-12-4-5-12)10-13-6-7-15(14(22)8-13)25-11-18(19,20)21/h6-8,12H,4-5,9-11H2,1-3H3 |
| InChIKey | FOMUKFHGYAJJHL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.28 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|