C17H23F3INO3 — CID 169493318
tert-butyl N-[[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-propylcarbamate (PubChem CID 169493318) has the molecular formula C17H23F3INO3 and a molecular weight of 473.27 g/mol. Its IUPAC name is tert-butyl N-[[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 169493318 |
| Molecular Formula | C17H23F3INO3 |
| Molecular Weight | 473.27 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | tert-butyl N-[[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-propylcarbamate |
| SMILES | CCCN(Cc1ccc(OCC(F)(F)F)c(I)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23F3INO3/c1-5-8-22(15(23)25-16(2,3)4)10-12-6-7-14(13(21)9-12)24-11-17(18,19)20/h6-7,9H,5,8,10-11H2,1-4H3 |
| InChIKey | PTDSBLQWYKNOIN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.27 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|