C12H6F3NS — CID 169493431
5-ethynyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazole (PubChem CID 169493431) has the molecular formula C12H6F3NS and a molecular weight of 253.25 g/mol. Its IUPAC name is 5-ethynyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazole.
| Compound Name | 5-ethynyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 169493431 |
| Molecular Formula | C12H6F3NS |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 5-ethynyl-2-[2-(trifluoromethyl)phenyl]-1,3-thiazole |
| SMILES | C#Cc1cnc(-c2ccccc2C(F)(F)F)s1 |
| InChI | InChI=1S/C12H6F3NS/c1-2-8-7-16-11(17-8)9-5-3-4-6-10(9)12(13,14)15/h1,3-7H |
| InChIKey | KZHCYBZSHPWZOI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|