C19H18N4O5S — CID 16959709
(E)-2-cyano-3-(3-nitro-4-propan-2-ylphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 16959709) has the molecular formula C19H18N4O5S and a molecular weight of 414.44 g/mol. Its IUPAC name is (E)-2-cyano-3-(3-nitro-4-propan-2-ylphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3-nitro-4-propan-2-ylphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16959709 |
| Molecular Formula | C19H18N4O5S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (E)-2-cyano-3-(3-nitro-4-propan-2-ylphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(/C=C(\C#N)C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N4O5S/c1-12(2)17-8-3-13(10-18(17)23(25)26)9-14(11-20)19(24)22-15-4-6-16(7-5-15)29(21,27)28/h3-10,12H,1-2H3,(H,22,24)(H2,21,27,28)/b14-9+ |
| InChIKey | BDNOIBWJDYPPOR-NTEUORMPSA-N |
| XLogP | 2.91 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|