C13H12N2O — CID 16966
4-Methoxyazobenzene (PubChem CID 16966) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is (4-methoxyphenyl)-phenyldiazene.
| Compound Name | 4-Methoxyazobenzene |
|---|---|
| PubChem CID | 16966 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (4-methoxyphenyl)-phenyldiazene |
| SMILES | COC1=CC=C(C=C1)N=NC2=CC=CC=C2 |
| InChIKey | LGCRPKOHRIXSEG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 34.00 Ų |
| H-Bond Donors | 0 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 216 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|