C31H29N3O — CID 16979897
N-[2-[1-(1-phenylethyl)benzimidazol-2-yl]ethyl]-2-(4-phenylphenyl)acetamide (PubChem CID 16979897) has the molecular formula C31H29N3O and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[2-[1-(1-phenylethyl)benzimidazol-2-yl]ethyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[2-[1-(1-phenylethyl)benzimidazol-2-yl]ethyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16979897 |
| Molecular Formula | C31H29N3O |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[2-[1-(1-phenylethyl)benzimidazol-2-yl]ethyl]-2-(4-phenylphenyl)acetamide |
| SMILES | CC(c1ccccc1)n1c(CCNC(=O)Cc2ccc(-c3ccccc3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C31H29N3O/c1-23(25-10-4-2-5-11-25)34-29-15-9-8-14-28(29)33-30(34)20-21-32-31(35)22-24-16-18-27(19-17-24)26-12-6-3-7-13-26/h2-19,23H,20-22H2,1H3,(H,32,35) |
| InChIKey | DWDAFAWFCAOBJL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |