C24H41ClN2O6S — CID 170006555
(5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-cyclopentyl-7-methyl-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 170006555) has the molecular formula C24H41ClN2O6S and a molecular weight of 521.12 g/mol. Its IUPAC name is (5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-cyclopentyl-7-methyl-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | (5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-cyclopentyl-7-methyl-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 170006555 |
| Molecular Formula | C24H41ClN2O6S |
| Molecular Weight | 521.12 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | (5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-cyclopentyl-7-methyl-2,3,4,5,5a,6,8,8a-octahydrooxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | CSC1OC([C@H](NC(=O)[C@@H]2[C@@H]3OCCC(C4CCCC4)C[C@H]3CN2C)[C@H](C)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C24H41ClN2O6S/c1-12(25)16(22-19(29)18(28)20(30)24(33-22)34-3)26-23(31)17-21-15(11-27(17)2)10-14(8-9-32-21)13-6-4-5-7-13/h12-22,24,28-30H,4-11H2,1-3H3,(H,26,31)/t12-,14?,15-,16+,17-,18?,19?,20?,21+,22?,24?/m0/s1 |
| InChIKey | JNJWIYNCTPIKOV-NFDIFGPASA-N |
| XLogP | 1.18 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.12 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|