C8H16O10S3 — CID 170018991
1-[(2,2-dioxo-1,3,2-dioxathiolan-4-yl)methoxysulfinyloxy]butan-2-yl methanesulfonate (PubChem CID 170018991) has the molecular formula C8H16O10S3 and a molecular weight of 368.41 g/mol. Its IUPAC name is 1-[(2,2-dioxo-1,3,2-dioxathiolan-4-yl)methoxysulfinyloxy]butan-2-yl methanesulfonate.
| Compound Name | 1-[(2,2-dioxo-1,3,2-dioxathiolan-4-yl)methoxysulfinyloxy]butan-2-yl methanesulfonate |
|---|---|
| PubChem CID | 170018991 |
| Molecular Formula | C8H16O10S3 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 1-[(2,2-dioxo-1,3,2-dioxathiolan-4-yl)methoxysulfinyloxy]butan-2-yl methanesulfonate |
| SMILES | CCC(COS(=O)OCC1COS(=O)(=O)O1)OS(C)(=O)=O |
| InChI | InChI=1S/C8H16O10S3/c1-3-7(17-20(2,10)11)4-14-19(9)15-5-8-6-16-21(12,13)18-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | OPOIYKVTJRABSU-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|