C5H10O7S2 — CID 129389133
[(4R)-2,2-dioxo-1,3,2-dioxathiolan-4-yl]methyl ethanesulfonate (PubChem CID 129389133) has the molecular formula C5H10O7S2 and a molecular weight of 246.26 g/mol. Its IUPAC name is [(4R)-2,2-dioxo-1,3,2-dioxathiolan-4-yl]methyl ethanesulfonate.
| Compound Name | [(4R)-2,2-dioxo-1,3,2-dioxathiolan-4-yl]methyl ethanesulfonate |
|---|---|
| PubChem CID | 129389133 |
| Molecular Formula | C5H10O7S2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | [(4R)-2,2-dioxo-1,3,2-dioxathiolan-4-yl]methyl ethanesulfonate |
| SMILES | CCS(=O)(=O)OC[C@@H]1COS(=O)(=O)O1 |
| InChI | InChI=1S/C5H10O7S2/c1-2-13(6,7)10-3-5-4-11-14(8,9)12-5/h5H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | QIMBXRIKXFKTLQ-RXMQYKEDSA-N |
| XLogP | -0.99 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|