C12H26N4 — CID 170022411
N-methyl-N'-[1-(1-methylpiperidin-3-yl)azetidin-3-yl]ethane-1,2-diamine (PubChem CID 170022411) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is N-methyl-N'-[1-(1-methylpiperidin-3-yl)azetidin-3-yl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-[1-(1-methylpiperidin-3-yl)azetidin-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 170022411 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | N-methyl-N'-[1-(1-methylpiperidin-3-yl)azetidin-3-yl]ethane-1,2-diamine |
| SMILES | CNCCNC1CN(C2CCCN(C)C2)C1 |
| InChI | InChI=1S/C12H26N4/c1-13-5-6-14-11-8-16(9-11)12-4-3-7-15(2)10-12/h11-14H,3-10H2,1-2H3 |
| InChIKey | OVNAILDXJIFLLT-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|