C27H44S3 — CID 170024253
hexacyclo[13.5.4.14,19.15,8.121,24.010,16]heptacosane-10,15,16-trithiol (PubChem CID 170024253) has the molecular formula C27H44S3 and a molecular weight of 464.85 g/mol. Its IUPAC name is hexacyclo[13.5.4.14,19.15,8.121,24.010,16]heptacosane-10,15,16-trithiol.
| Compound Name | hexacyclo[13.5.4.14,19.15,8.121,24.010,16]heptacosane-10,15,16-trithiol |
|---|---|
| PubChem CID | 170024253 |
| Molecular Formula | C27H44S3 |
| Molecular Weight | 464.85 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | hexacyclo[13.5.4.14,19.15,8.121,24.010,16]heptacosane-10,15,16-trithiol |
| SMILES | SC12CCCCC3(S)C4CCC(C4)C4CCC(CC(CCC13S)C4)C1CCC(C1)C2 |
| InChI | InChI=1S/C27H44S3/c28-25-10-1-2-11-26(29)24-8-7-23(16-24)22-6-5-21(20-4-3-19(15-20)17-25)13-18(14-22)9-12-27(25,26)30/h18-24,28-30H,1-17H2 |
| InChIKey | HTAAQZLTKZYLDN-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.85 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|