About (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine
(Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine (PubChem CID 170025013) has the molecular formula C9H19NS
and a molecular weight of 173.32 g/mol. Its IUPAC name is (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine.
Molecular Properties
| Compound Name | (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine |
| PubChem CID | 170025013 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine |
| SMILES | CS/C(=C(\N)C(C)C)C(C)C |
| InChI | InChI=1S/C9H19NS/c1-6(2)8(10)9(11-5)7(3)4/h6-7H,10H2,1-5H3/b9-8- |
| InChIKey | SQSZKYLOHYVUSZ-HJWRWDBZSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine?
The IUPAC name of (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine (CID 170025013) is (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine.
What is the SMILES notation for (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine?
The canonical SMILES for (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine is CS/C(=C(\N)C(C)C)C(C)C.
What is the InChIKey of (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine?
The InChIKey is SQSZKYLOHYVUSZ-HJWRWDBZSA-N. The full InChI is InChI=1S/C9H19NS/c1-6(2)8(10)9(11-5)7(3)4/h6-7H,10H2,1-5H3/b9-8-.
What are the key properties of (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine?
(Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine has a molecular weight of 173.32 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine is sourced from PubChem (CID 170025013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).