C9H19NS — CID 170025013
(Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine (PubChem CID 170025013) has the molecular formula C9H19NS and a molecular weight of 173.32 g/mol. Its IUPAC name is (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine.
| Compound Name | (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine |
|---|---|
| PubChem CID | 170025013 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (Z)-2,5-dimethyl-4-methylsulfanylhex-3-en-3-amine |
| SMILES | CS/C(=C(\N)C(C)C)C(C)C |
| InChI | InChI=1S/C9H19NS/c1-6(2)8(10)9(11-5)7(3)4/h6-7H,10H2,1-5H3/b9-8- |
| InChIKey | SQSZKYLOHYVUSZ-HJWRWDBZSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |