C30H21IN4 — CID 170025602
4-iodo-2-[3-[4-(2-methyl-4-phenyl-1H-imidazol-5-yl)phenyl]phenyl]quinazoline (PubChem CID 170025602) has the molecular formula C30H21IN4 and a molecular weight of 564.43 g/mol. Its IUPAC name is 4-iodo-2-[3-[4-(2-methyl-4-phenyl-1H-imidazol-5-yl)phenyl]phenyl]quinazoline.
| Compound Name | 4-iodo-2-[3-[4-(2-methyl-4-phenyl-1H-imidazol-5-yl)phenyl]phenyl]quinazoline |
|---|---|
| PubChem CID | 170025602 |
| Molecular Formula | C30H21IN4 |
| Molecular Weight | 564.43 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | 4-iodo-2-[3-[4-(2-methyl-4-phenyl-1H-imidazol-5-yl)phenyl]phenyl]quinazoline |
| SMILES | Cc1nc(-c2ccccc2)c(-c2ccc(-c3cccc(-c4nc(I)c5ccccc5n4)c3)cc2)[nH]1 |
| InChI | InChI=1S/C30H21IN4/c1-19-32-27(21-8-3-2-4-9-21)28(33-19)22-16-14-20(15-17-22)23-10-7-11-24(18-23)30-34-26-13-6-5-12-25(26)29(31)35-30/h2-18H,1H3,(H,32,33) |
| InChIKey | SEBCFDFDQBKVPP-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.43 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|