C29H40N4O3 — CID 170026590
2-[7-[3-[1-(cyclohexylmethyl)piperidin-4-yl]oxyprop-1-ynyl]-1-methylindazol-3-yl]-N-methyl-5-oxopentanamide (PubChem CID 170026590) has the molecular formula C29H40N4O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is 2-[7-[3-[1-(cyclohexylmethyl)piperidin-4-yl]oxyprop-1-ynyl]-1-methylindazol-3-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[3-[1-(cyclohexylmethyl)piperidin-4-yl]oxyprop-1-ynyl]-1-methylindazol-3-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 170026590 |
| Molecular Formula | C29H40N4O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | 2-[7-[3-[1-(cyclohexylmethyl)piperidin-4-yl]oxyprop-1-ynyl]-1-methylindazol-3-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)c1nn(C)c2c(C#CCOC3CCN(CC4CCCCC4)CC3)cccc12 |
| InChI | InChI=1S/C29H40N4O3/c1-30-29(35)26(14-7-19-34)27-25-13-6-11-23(28(25)32(2)31-27)12-8-20-36-24-15-17-33(18-16-24)21-22-9-4-3-5-10-22/h6,11,13,19,22,24,26H,3-5,7,9-10,14-18,20-21H2,1-2H3,(H,30,35) |
| InChIKey | VIQJXSOYHABBNA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|