C36H42FN5O5 — CID 170033068
3-[3-fluoro-4-[4-[1-[2-hydroxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)benzoyl]piperidin-4-yl]piperidin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 170033068) has the molecular formula C36H42FN5O5 and a molecular weight of 643.76 g/mol. Its IUPAC name is 3-[3-fluoro-4-[4-[1-[2-hydroxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)benzoyl]piperidin-4-yl]piperidin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[3-fluoro-4-[4-[1-[2-hydroxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)benzoyl]piperidin-4-yl]piperidin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170033068 |
| Molecular Formula | C36H42FN5O5 |
| Molecular Weight | 643.76 g/mol |
| Exact Mass | 643.32 |
| IUPAC Name | 3-[3-fluoro-4-[4-[1-[2-hydroxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)benzoyl]piperidin-4-yl]piperidin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | Cc1c(-c2ccc(C(=O)N3CCC(C4CCN(c5ccc(NC6CCC(=O)NC6=O)cc5F)CC4)CC3)c(O)c2)cn(C)c(=O)c1C |
| InChI | InChI=1S/C36H42FN5O5/c1-21-22(2)35(46)40(3)20-28(21)25-4-6-27(32(43)18-25)36(47)42-16-12-24(13-17-42)23-10-14-41(15-11-23)31-8-5-26(19-29(31)37)38-30-7-9-33(44)39-34(30)45/h4-6,8,18-20,23-24,30,38,43H,7,9-17H2,1-3H3,(H,39,44,45) |
| InChIKey | ZZFPJIYWZOOTLH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.76 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|